C19H25NO3 — CID 91494855
7-(3-cyclopentyloxy-4-methoxyphenyl)-5-oxa-6-azaspiro[3.5]non-7-ene (PubChem CID 91494855) has the molecular formula C19H25NO3 and a molecular weight of 315.41 g/mol. Its IUPAC name is 7-(3-cyclopentyloxy-4-methoxyphenyl)-5-oxa-6-azaspiro[3.5]non-7-ene.
| Compound Name | 7-(3-cyclopentyloxy-4-methoxyphenyl)-5-oxa-6-azaspiro[3.5]non-7-ene |
|---|---|
| PubChem CID | 91494855 |
| Molecular Formula | C19H25NO3 |
| Molecular Weight | 315.41 g/mol |
| Exact Mass | 315.18 |
| IUPAC Name | 7-(3-cyclopentyloxy-4-methoxyphenyl)-5-oxa-6-azaspiro[3.5]non-7-ene |
| SMILES | COc1ccc(C2=CCC3(CCC3)ON2)cc1OC1CCCC1 |
| InChI | InChI=1S/C19H25NO3/c1-21-17-8-7-14(13-18(17)22-15-5-2-3-6-15)16-9-12-19(23-20-16)10-4-11-19/h7-9,13,15,20H,2-6,10-12H2,1H3 |
| InChIKey | NXHIXBDTCPSZLM-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.41 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |