C25H37OP — CID 90923665
2-methylbutyl-[4-[2-[4-(2-methylbutyl)phenyl]propan-2-yl]phenoxy]phosphane (PubChem CID 90923665) has the molecular formula C25H37OP and a molecular weight of 384.54 g/mol. Its IUPAC name is 2-methylbutyl-[4-[2-[4-(2-methylbutyl)phenyl]propan-2-yl]phenoxy]phosphane.
| Compound Name | 2-methylbutyl-[4-[2-[4-(2-methylbutyl)phenyl]propan-2-yl]phenoxy]phosphane |
|---|---|
| PubChem CID | 90923665 |
| Molecular Formula | C25H37OP |
| Molecular Weight | 384.54 g/mol |
| Exact Mass | 384.26 |
| IUPAC Name | 2-methylbutyl-[4-[2-[4-(2-methylbutyl)phenyl]propan-2-yl]phenoxy]phosphane |
| SMILES | CCC(C)CPOc1ccc(C(C)(C)c2ccc(CC(C)CC)cc2)cc1 |
| InChI | InChI=1S/C25H37OP/c1-7-19(3)17-21-9-11-22(12-10-21)25(5,6)23-13-15-24(16-14-23)26-27-18-20(4)8-2/h9-16,19-20,27H,7-8,17-18H2,1-6H3 |
| InChIKey | HZGUBSCZPMDNPX-UHFFFAOYSA-N |
| XLogP | 7.62 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.54 |
| LogP ≤ 5 | 7.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|