C29H62N6O2 — CID 90923838
2-[3-[4-(3-aminopropylamino)butylamino]propylcarbamoylamino]-N,N-dioctylacetamide (PubChem CID 90923838) has the molecular formula C29H62N6O2 and a molecular weight of 526.86 g/mol. Its IUPAC name is 2-[3-[4-(3-aminopropylamino)butylamino]propylcarbamoylamino]-N,N-dioctylacetamide.
| Compound Name | 2-[3-[4-(3-aminopropylamino)butylamino]propylcarbamoylamino]-N,N-dioctylacetamide |
|---|---|
| PubChem CID | 90923838 |
| Molecular Formula | C29H62N6O2 |
| Molecular Weight | 526.86 g/mol |
| Exact Mass | 526.49 |
| IUPAC Name | 2-[3-[4-(3-aminopropylamino)butylamino]propylcarbamoylamino]-N,N-dioctylacetamide |
| SMILES | CCCCCCCCN(CCCCCCCC)C(=O)CNC(=O)NCCCNCCCCNCCCN |
| InChI | InChI=1S/C29H62N6O2/c1-3-5-7-9-11-15-25-35(26-16-12-10-8-6-4-2)28(36)27-34-29(37)33-24-18-23-32-21-14-13-20-31-22-17-19-30/h31-32H,3-27,30H2,1-2H3,(H2,33,34,37) |
| InChIKey | XECVTJUJEJAWDJ-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 111.52 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.86 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|