C8H4 — CID 90925138
1,3-diethynylcyclobuta-1,3-diene (PubChem CID 90925138) has the molecular formula C8H4 and a molecular weight of 100.12 g/mol. Its IUPAC name is 1,3-diethynylcyclobuta-1,3-diene.
| Compound Name | 1,3-diethynylcyclobuta-1,3-diene |
|---|---|
| PubChem CID | 90925138 |
| Molecular Formula | C8H4 |
| Molecular Weight | 100.12 g/mol |
| Exact Mass | 100.03 |
| IUPAC Name | 1,3-diethynylcyclobuta-1,3-diene |
| SMILES | C#CC1=CC(C#C)=C1 |
| InChI | InChI=1S/C8H4/c1-3-7-5-8(4-2)6-7/h1-2,5-6H |
| InChIKey | IRAQOGPKMAXTQY-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 100.12 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|