C8H7F — CID 177135494
(3E)-3-fluoro-5-methylidenehepta-1,3-dien-6-yne (PubChem CID 177135494) has the molecular formula C8H7F and a molecular weight of 122.14 g/mol. Its IUPAC name is (3E)-3-fluoro-5-methylidenehepta-1,3-dien-6-yne.
| Compound Name | (3E)-3-fluoro-5-methylidenehepta-1,3-dien-6-yne |
|---|---|
| PubChem CID | 177135494 |
| Molecular Formula | C8H7F |
| Molecular Weight | 122.14 g/mol |
| Exact Mass | 122.05 |
| IUPAC Name | (3E)-3-fluoro-5-methylidenehepta-1,3-dien-6-yne |
| SMILES | C#CC(=C)/C=C(/F)C=C |
| InChI | InChI=1S/C8H7F/c1-4-7(3)6-8(9)5-2/h1,5-6H,2-3H2/b8-6+ |
| InChIKey | JTDODFWBKSFQLD-SOFGYWHQSA-N |
| XLogP | 2.22 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 122.14 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|