C8H7F — CID 91217887
2-ethynyl-5-fluorocyclohexa-1,3-diene (PubChem CID 91217887) has the molecular formula C8H7F and a molecular weight of 122.14 g/mol. Its IUPAC name is 2-ethynyl-5-fluorocyclohexa-1,3-diene.
| Compound Name | 2-ethynyl-5-fluorocyclohexa-1,3-diene |
|---|---|
| PubChem CID | 91217887 |
| Molecular Formula | C8H7F |
| Molecular Weight | 122.14 g/mol |
| Exact Mass | 122.05 |
| IUPAC Name | 2-ethynyl-5-fluorocyclohexa-1,3-diene |
| SMILES | C#CC1=CCC(F)C=C1 |
| InChI | InChI=1S/C8H7F/c1-2-7-3-5-8(9)6-4-7/h1,3-5,8H,6H2 |
| InChIKey | UAYHTFUJGZDYAL-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 122.14 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|