C12H22O2 — CID 90925683
(1S)-1-[(1S,2R)-2-[(1S)-1-hydroxyethyl]-1-methylcyclopentyl]but-3-en-1-ol (PubChem CID 90925683) has the molecular formula C12H22O2 and a molecular weight of 198.31 g/mol. Its IUPAC name is (1S)-1-[(1S,2R)-2-[(1S)-1-hydroxyethyl]-1-methylcyclopentyl]but-3-en-1-ol.
| Compound Name | (1S)-1-[(1S,2R)-2-[(1S)-1-hydroxyethyl]-1-methylcyclopentyl]but-3-en-1-ol |
|---|---|
| PubChem CID | 90925683 |
| Molecular Formula | C12H22O2 |
| Molecular Weight | 198.31 g/mol |
| Exact Mass | 198.16 |
| IUPAC Name | (1S)-1-[(1S,2R)-2-[(1S)-1-hydroxyethyl]-1-methylcyclopentyl]but-3-en-1-ol |
| SMILES | C=CC[C@H](O)[C@@]1(C)CCC[C@H]1[C@H](C)O |
| InChI | InChI=1S/C12H22O2/c1-4-6-11(14)12(3)8-5-7-10(12)9(2)13/h4,9-11,13-14H,1,5-8H2,2-3H3/t9-,10-,11-,12-/m0/s1 |
| InChIKey | NMHFQPHEQNPVJQ-BJDJZHNGSA-N |
| XLogP | 2.11 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.31 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|