C17H27NO4 — CID 90926430
[(2S)-5-[[(2R,3R,5S,6S)-2,5-dimethyl-6-prop-2-enyloxan-3-yl]amino]-5-oxopent-3-en-2-yl] acetate (PubChem CID 90926430) has the molecular formula C17H27NO4 and a molecular weight of 309.41 g/mol. Its IUPAC name is [(2S)-5-[[(2R,3R,5S,6S)-2,5-dimethyl-6-prop-2-enyloxan-3-yl]amino]-5-oxopent-3-en-2-yl] acetate.
| Compound Name | [(2S)-5-[[(2R,3R,5S,6S)-2,5-dimethyl-6-prop-2-enyloxan-3-yl]amino]-5-oxopent-3-en-2-yl] acetate |
|---|---|
| PubChem CID | 90926430 |
| Molecular Formula | C17H27NO4 |
| Molecular Weight | 309.41 g/mol |
| Exact Mass | 309.19 |
| IUPAC Name | [(2S)-5-[[(2R,3R,5S,6S)-2,5-dimethyl-6-prop-2-enyloxan-3-yl]amino]-5-oxopent-3-en-2-yl] acetate |
| SMILES | C=CC[C@@H]1O[C@H](C)[C@H](NC(=O)C=C[C@H](C)OC(C)=O)C[C@@H]1C |
| InChI | InChI=1S/C17H27NO4/c1-6-7-16-11(2)10-15(13(4)22-16)18-17(20)9-8-12(3)21-14(5)19/h6,8-9,11-13,15-16H,1,7,10H2,2-5H3,(H,18,20)/t11-,12-,13+,15+,16-/m0/s1 |
| InChIKey | MJWSAUYYUNEFES-CNBXADPUSA-N |
| XLogP | 2.37 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.41 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|