C19H27N3O9 — CID 90927249
(2R)-2-amino-2-[[3,5-bis(ethoxycarbonyl)-2,6-dimethyl-3,4-dihydropyridine-4-carbonyl]amino]pentanedioic acid (PubChem CID 90927249) has the molecular formula C19H27N3O9 and a molecular weight of 441.44 g/mol. Its IUPAC name is (2R)-2-amino-2-[[3,5-bis(ethoxycarbonyl)-2,6-dimethyl-3,4-dihydropyridine-4-carbonyl]amino]pentanedioic acid.
| Compound Name | (2R)-2-amino-2-[[3,5-bis(ethoxycarbonyl)-2,6-dimethyl-3,4-dihydropyridine-4-carbonyl]amino]pentanedioic acid |
|---|---|
| PubChem CID | 90927249 |
| Molecular Formula | C19H27N3O9 |
| Molecular Weight | 441.44 g/mol |
| Exact Mass | 441.17 |
| IUPAC Name | (2R)-2-amino-2-[[3,5-bis(ethoxycarbonyl)-2,6-dimethyl-3,4-dihydropyridine-4-carbonyl]amino]pentanedioic acid |
| SMILES | CCOC(=O)C1=C(C)N=C(C)C(C(=O)OCC)C1C(=O)N[C@](N)(CCC(=O)O)C(=O)O |
| InChI | InChI=1S/C19H27N3O9/c1-5-30-16(26)12-9(3)21-10(4)13(17(27)31-6-2)14(12)15(25)22-19(20,18(28)29)8-7-11(23)24/h12,14H,5-8,20H2,1-4H3,(H,22,25)(H,23,24)(H,28,29)/t12?,14?,19-/m1/s1 |
| InChIKey | BQXYFHPMDSBBJC-JWIMFUQQSA-N |
| XLogP | -0.19 |
| TPSA | 194.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.44 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|