C27H48O2Si — CID 90927718
(8R,9S,10S,13S,14S,17R)-3-[butyl(dimethyl)silyl]oxy-17-ethenyl-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-16-ol (PubChem CID 90927718) has the molecular formula C27H48O2Si and a molecular weight of 432.77 g/mol. Its IUPAC name is (8R,9S,10S,13S,14S,17R)-3-[butyl(dimethyl)silyl]oxy-17-ethenyl-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-16-ol.
| Compound Name | (8R,9S,10S,13S,14S,17R)-3-[butyl(dimethyl)silyl]oxy-17-ethenyl-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-16-ol |
|---|---|
| PubChem CID | 90927718 |
| Molecular Formula | C27H48O2Si |
| Molecular Weight | 432.77 g/mol |
| Exact Mass | 432.34 |
| IUPAC Name | (8R,9S,10S,13S,14S,17R)-3-[butyl(dimethyl)silyl]oxy-17-ethenyl-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-16-ol |
| SMILES | C=C[C@H]1C(O)C[C@H]2[C@@H]3CCC4CC(O[Si](C)(C)CCCC)CC[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C27H48O2Si/c1-7-9-16-30(5,6)29-20-12-14-26(3)19(17-20)10-11-21-23(26)13-15-27(4)22(8-2)25(28)18-24(21)27/h8,19-25,28H,2,7,9-18H2,1,3-6H3/t19?,20?,21-,22+,23+,24+,25?,26+,27-/m1/s1 |
| InChIKey | SGHSOOKGRSSVCS-BCGXVJRFSA-N |
| XLogP | 7.19 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.77 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|