C10H11BrClNO4S — CID 90928304
(4-amino-4-oxobutyl) 4-bromo-2-chlorobenzenesulfonate (PubChem CID 90928304) has the molecular formula C10H11BrClNO4S and a molecular weight of 356.63 g/mol. Its IUPAC name is (4-amino-4-oxobutyl) 4-bromo-2-chlorobenzenesulfonate.
| Compound Name | (4-amino-4-oxobutyl) 4-bromo-2-chlorobenzenesulfonate |
|---|---|
| PubChem CID | 90928304 |
| Molecular Formula | C10H11BrClNO4S |
| Molecular Weight | 356.63 g/mol |
| Exact Mass | 354.93 |
| IUPAC Name | (4-amino-4-oxobutyl) 4-bromo-2-chlorobenzenesulfonate |
| SMILES | NC(=O)CCCOS(=O)(=O)c1ccc(Br)cc1Cl |
| InChI | InChI=1S/C10H11BrClNO4S/c11-7-3-4-9(8(12)6-7)18(15,16)17-5-1-2-10(13)14/h3-4,6H,1-2,5H2,(H2,13,14) |
| InChIKey | OVZDGHQKPPINFA-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 86.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.63 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|