C52H79N2+ — CID 90928757
6-[2-[2-(4-tert-butylphenyl)ethenyl]-7-(3,3-dimethylbut-1-enyl)-9-[6-[di(propan-2-yl)amino]hexyl]fluoren-9-yl]hexyl-trimethylazanium (PubChem CID 90928757) has the molecular formula C52H79N2+ and a molecular weight of 732.22 g/mol. Its IUPAC name is 6-[2-[2-(4-tert-butylphenyl)ethenyl]-7-(3,3-dimethylbut-1-enyl)-9-[6-[di(propan-2-yl)amino]hexyl]fluoren-9-yl]hexyl-trimethylazanium.
| Compound Name | 6-[2-[2-(4-tert-butylphenyl)ethenyl]-7-(3,3-dimethylbut-1-enyl)-9-[6-[di(propan-2-yl)amino]hexyl]fluoren-9-yl]hexyl-trimethylazanium |
|---|---|
| PubChem CID | 90928757 |
| Molecular Formula | C52H79N2+ |
| Molecular Weight | 732.22 g/mol |
| Exact Mass | 731.62 |
| IUPAC Name | 6-[2-[2-(4-tert-butylphenyl)ethenyl]-7-(3,3-dimethylbut-1-enyl)-9-[6-[di(propan-2-yl)amino]hexyl]fluoren-9-yl]hexyl-trimethylazanium |
| SMILES | CC(C)N(CCCCCCC1(CCCCCC[N+](C)(C)C)c2cc(C=Cc3ccc(C(C)(C)C)cc3)ccc2-c2ccc(C=CC(C)(C)C)cc21)C(C)C |
| InChI | InChI=1S/C52H79N2/c1-40(2)53(41(3)4)36-20-16-14-18-33-52(34-19-15-17-21-37-54(11,12)13)48-38-43(23-22-42-24-28-45(29-25-42)51(8,9)10)26-30-46(48)47-31-27-44(39-49(47)52)32-35-50(5,6)7/h22-32,35,38-41H,14-21,33-34,36-37H2,1-13H3/q+1 |
| InChIKey | VTPDIRZZMMGYRF-UHFFFAOYSA-N |
| XLogP | 14.21 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 732.22 |
| LogP ≤ 5 | 14.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|