C14H15BrN2O3 — CID 90928789
[4-(3-bromo-2,5-dihydro-1,2-oxazol-5-yl)phenyl]-morpholin-4-ylmethanone (PubChem CID 90928789) has the molecular formula C14H15BrN2O3 and a molecular weight of 339.19 g/mol. Its IUPAC name is [4-(3-bromo-2,5-dihydro-1,2-oxazol-5-yl)phenyl]-morpholin-4-ylmethanone.
| Compound Name | [4-(3-bromo-2,5-dihydro-1,2-oxazol-5-yl)phenyl]-morpholin-4-ylmethanone |
|---|---|
| PubChem CID | 90928789 |
| Molecular Formula | C14H15BrN2O3 |
| Molecular Weight | 339.19 g/mol |
| Exact Mass | 338.03 |
| IUPAC Name | [4-(3-bromo-2,5-dihydro-1,2-oxazol-5-yl)phenyl]-morpholin-4-ylmethanone |
| SMILES | O=C(c1ccc(C2C=C(Br)NO2)cc1)N1CCOCC1 |
| InChI | InChI=1S/C14H15BrN2O3/c15-13-9-12(20-16-13)10-1-3-11(4-2-10)14(18)17-5-7-19-8-6-17/h1-4,9,12,16H,5-8H2 |
| InChIKey | SBKHUOPDQDSDMU-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.19 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|