C26H32ClN3O3S — CID 90934121
6-chloro-N-[4-[4-(2,4-dimethoxyphenyl)piperazin-1-yl]butyl]-2H-thiochromene-3-carboxamide (PubChem CID 90934121) has the molecular formula C26H32ClN3O3S and a molecular weight of 502.08 g/mol. Its IUPAC name is 6-chloro-N-[4-[4-(2,4-dimethoxyphenyl)piperazin-1-yl]butyl]-2H-thiochromene-3-carboxamide.
| Compound Name | 6-chloro-N-[4-[4-(2,4-dimethoxyphenyl)piperazin-1-yl]butyl]-2H-thiochromene-3-carboxamide |
|---|---|
| PubChem CID | 90934121 |
| Molecular Formula | C26H32ClN3O3S |
| Molecular Weight | 502.08 g/mol |
| Exact Mass | 501.19 |
| IUPAC Name | 6-chloro-N-[4-[4-(2,4-dimethoxyphenyl)piperazin-1-yl]butyl]-2H-thiochromene-3-carboxamide |
| SMILES | COc1ccc(N2CCN(CCCCNC(=O)C3=Cc4cc(Cl)ccc4SC3)CC2)c(OC)c1 |
| InChI | InChI=1S/C26H32ClN3O3S/c1-32-22-6-7-23(24(17-22)33-2)30-13-11-29(12-14-30)10-4-3-9-28-26(31)20-15-19-16-21(27)5-8-25(19)34-18-20/h5-8,15-17H,3-4,9-14,18H2,1-2H3,(H,28,31) |
| InChIKey | MMQTZUNKNJFEKA-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 54.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.08 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|