C24H27Cl2N3OS — CID 68863998
6-chloro-N-[4-[4-(3-chlorophenyl)piperazin-1-yl]butyl]-2H-thiochromene-3-carboxamide (PubChem CID 68863998) has the molecular formula C24H27Cl2N3OS and a molecular weight of 476.47 g/mol. Its IUPAC name is 6-chloro-N-[4-[4-(3-chlorophenyl)piperazin-1-yl]butyl]-2H-thiochromene-3-carboxamide.
| Compound Name | 6-chloro-N-[4-[4-(3-chlorophenyl)piperazin-1-yl]butyl]-2H-thiochromene-3-carboxamide |
|---|---|
| PubChem CID | 68863998 |
| Molecular Formula | C24H27Cl2N3OS |
| Molecular Weight | 476.47 g/mol |
| Exact Mass | 475.13 |
| IUPAC Name | 6-chloro-N-[4-[4-(3-chlorophenyl)piperazin-1-yl]butyl]-2H-thiochromene-3-carboxamide |
| SMILES | O=C(NCCCCN1CCN(c2cccc(Cl)c2)CC1)C1=Cc2cc(Cl)ccc2SC1 |
| InChI | InChI=1S/C24H27Cl2N3OS/c25-20-4-3-5-22(16-20)29-12-10-28(11-13-29)9-2-1-8-27-24(30)19-14-18-15-21(26)6-7-23(18)31-17-19/h3-7,14-16H,1-2,8-13,17H2,(H,27,30) |
| InChIKey | YLRLNGQYUBGOMC-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.47 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|