About 3-butyl-1-propylpyrazole
3-butyl-1-propylpyrazole (PubChem CID 90936272) has the molecular formula C10H18N2
and a molecular weight of 166.27 g/mol. Its IUPAC name is 3-butyl-1-propylpyrazole.
Molecular Properties
| Compound Name | 3-butyl-1-propylpyrazole |
| PubChem CID | 90936272 |
| Molecular Formula | C10H18N2 |
| Molecular Weight | 166.27 g/mol |
| Exact Mass | 166.15 |
| IUPAC Name | 3-butyl-1-propylpyrazole |
| SMILES | CCCCc1ccn(CCC)n1 |
| InChI | InChI=1S/C10H18N2/c1-3-5-6-10-7-9-12(11-10)8-4-2/h7,9H,3-6,8H2,1-2H3 |
| InChIKey | HXJMDNIWMXSWDU-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.27 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-butyl-1-propylpyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-butyl-1-propylpyrazole?
The IUPAC name of 3-butyl-1-propylpyrazole (CID 90936272) is 3-butyl-1-propylpyrazole.
What is the SMILES notation for 3-butyl-1-propylpyrazole?
The canonical SMILES for 3-butyl-1-propylpyrazole is CCCCc1ccn(CCC)n1.
What is the InChIKey of 3-butyl-1-propylpyrazole?
The InChIKey is HXJMDNIWMXSWDU-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18N2/c1-3-5-6-10-7-9-12(11-10)8-4-2/h7,9H,3-6,8H2,1-2H3.
What are the key properties of 3-butyl-1-propylpyrazole?
3-butyl-1-propylpyrazole has a molecular weight of 166.27 g/mol, XLogP of 2.64, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-butyl-1-propylpyrazole is sourced from PubChem (CID 90936272), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).