C25H23F2NO3S — CID 90937513
2-[bis(4-fluorophenyl)methyl]-1-(2-methylphenyl)sulfonylpiperidin-4-one (PubChem CID 90937513) has the molecular formula C25H23F2NO3S and a molecular weight of 455.53 g/mol. Its IUPAC name is 2-[bis(4-fluorophenyl)methyl]-1-(2-methylphenyl)sulfonylpiperidin-4-one.
| Compound Name | 2-[bis(4-fluorophenyl)methyl]-1-(2-methylphenyl)sulfonylpiperidin-4-one |
|---|---|
| PubChem CID | 90937513 |
| Molecular Formula | C25H23F2NO3S |
| Molecular Weight | 455.53 g/mol |
| Exact Mass | 455.14 |
| IUPAC Name | 2-[bis(4-fluorophenyl)methyl]-1-(2-methylphenyl)sulfonylpiperidin-4-one |
| SMILES | Cc1ccccc1S(=O)(=O)N1CCC(=O)CC1C(c1ccc(F)cc1)c1ccc(F)cc1 |
| InChI | InChI=1S/C25H23F2NO3S/c1-17-4-2-3-5-24(17)32(30,31)28-15-14-22(29)16-23(28)25(18-6-10-20(26)11-7-18)19-8-12-21(27)13-9-19/h2-13,23,25H,14-16H2,1H3 |
| InChIKey | OJXBWQSWULUHNL-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.53 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |