C11H21NO — CID 90939292
5-ethoxy-4-ethylidenehept-2-en-1-amine (PubChem CID 90939292) has the molecular formula C11H21NO and a molecular weight of 183.29 g/mol. Its IUPAC name is 5-ethoxy-4-ethylidenehept-2-en-1-amine.
| Compound Name | 5-ethoxy-4-ethylidenehept-2-en-1-amine |
|---|---|
| PubChem CID | 90939292 |
| Molecular Formula | C11H21NO |
| Molecular Weight | 183.29 g/mol |
| Exact Mass | 183.16 |
| IUPAC Name | 5-ethoxy-4-ethylidenehept-2-en-1-amine |
| SMILES | CC=C(C=CCN)C(CC)OCC |
| InChI | InChI=1S/C11H21NO/c1-4-10(8-7-9-12)11(5-2)13-6-3/h4,7-8,11H,5-6,9,12H2,1-3H3 |
| InChIKey | NDRJMLDRGGJOOQ-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.29 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|