C41H55N5O5 — CID 90941821
3-[8,13-diethyl-18-(hexylcarbamoyl)-20-(2-methoxy-2-oxoethyl)-3,7,12,17-tetramethyl-2,3,21,22,23,24-hexahydroporphyrin-2-yl]propanoic acid (PubChem CID 90941821) has the molecular formula C41H55N5O5 and a molecular weight of 697.92 g/mol. Its IUPAC name is 3-[8,13-diethyl-18-(hexylcarbamoyl)-20-(2-methoxy-2-oxoethyl)-3,7,12,17-tetramethyl-2,3,21,22,23,24-hexahydroporphyrin-2-yl]propanoic acid.
| Compound Name | 3-[8,13-diethyl-18-(hexylcarbamoyl)-20-(2-methoxy-2-oxoethyl)-3,7,12,17-tetramethyl-2,3,21,22,23,24-hexahydroporphyrin-2-yl]propanoic acid |
|---|---|
| PubChem CID | 90941821 |
| Molecular Formula | C41H55N5O5 |
| Molecular Weight | 697.92 g/mol |
| Exact Mass | 697.42 |
| IUPAC Name | 3-[8,13-diethyl-18-(hexylcarbamoyl)-20-(2-methoxy-2-oxoethyl)-3,7,12,17-tetramethyl-2,3,21,22,23,24-hexahydroporphyrin-2-yl]propanoic acid |
| SMILES | CCCCCCNC(=O)c1c2[nH]c(c1C)C=c1[nH]c(c(C)c1CC)=Cc1[nH]c(c(C)c1CC)C=C1NC(=C2CC(=O)OC)C(CCC(=O)O)C1C |
| InChI | InChI=1S/C41H55N5O5/c1-9-12-13-14-17-42-41(50)38-25(7)33-21-35-27(11-3)23(5)31(44-35)20-34-26(10-2)22(4)30(43-34)19-32-24(6)28(15-16-36(47)48)39(45-32)29(40(38)46-33)18-37(49)51-8/h19-21,24,28,43-46H,9-18H2,1-8H3,(H,42,50)(H,47,48) |
| InChIKey | XOSJGEDIGWPVAJ-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 152.10 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 51 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 697.92 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|