C18H19NO5 — CID 90942875
(3S)-3-[bis(phenylmethoxy)amino]-4-oxobutanoic acid (PubChem CID 90942875) has the molecular formula C18H19NO5 and a molecular weight of 329.35 g/mol. Its IUPAC name is (3S)-3-[bis(phenylmethoxy)amino]-4-oxobutanoic acid.
| Compound Name | (3S)-3-[bis(phenylmethoxy)amino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 90942875 |
| Molecular Formula | C18H19NO5 |
| Molecular Weight | 329.35 g/mol |
| Exact Mass | 329.13 |
| IUPAC Name | (3S)-3-[bis(phenylmethoxy)amino]-4-oxobutanoic acid |
| SMILES | O=C[C@H](CC(=O)O)N(OCc1ccccc1)OCc1ccccc1 |
| InChI | InChI=1S/C18H19NO5/c20-12-17(11-18(21)22)19(23-13-15-7-3-1-4-8-15)24-14-16-9-5-2-6-10-16/h1-10,12,17H,11,13-14H2,(H,21,22)/t17-/m0/s1 |
| InChIKey | QWRALEBPUWFDGI-KRWDZBQOSA-N |
| XLogP | 2.59 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.35 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|