C18H17IN2O6 — CID 87925477
(2S)-2-[[benzoyl(iodo)amino]-phenylmethoxyamino]butanedioic acid (PubChem CID 87925477) has the molecular formula C18H17IN2O6 and a molecular weight of 484.25 g/mol. Its IUPAC name is (2S)-2-[[benzoyl(iodo)amino]-phenylmethoxyamino]butanedioic acid.
| Compound Name | (2S)-2-[[benzoyl(iodo)amino]-phenylmethoxyamino]butanedioic acid |
|---|---|
| PubChem CID | 87925477 |
| Molecular Formula | C18H17IN2O6 |
| Molecular Weight | 484.25 g/mol |
| Exact Mass | 484.01 |
| IUPAC Name | (2S)-2-[[benzoyl(iodo)amino]-phenylmethoxyamino]butanedioic acid |
| SMILES | O=C(O)C[C@@H](C(=O)O)N(OCc1ccccc1)N(I)C(=O)c1ccccc1 |
| InChI | InChI=1S/C18H17IN2O6/c19-20(17(24)14-9-5-2-6-10-14)21(15(18(25)26)11-16(22)23)27-12-13-7-3-1-4-8-13/h1-10,15H,11-12H2,(H,22,23)(H,25,26)/t15-/m0/s1 |
| InChIKey | CQYBZQCQQVHTAR-HNNXBMFYSA-N |
| XLogP | 2.76 |
| TPSA | 107.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.25 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|