C27H25F3N3O7+ — CID 90944018
(4S,4aS,5aR,12aR)-4-(dimethylamino)-1,10,11,12a-tetrahydroxy-3,12-dioxo-7-[4-(trifluoromethyl)pyridin-1-ium-1-yl]-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide (PubChem CID 90944018) has the molecular formula C27H25F3N3O7+ and a molecular weight of 560.51 g/mol. Its IUPAC name is (4S,4aS,5aR,12aR)-4-(dimethylamino)-1,10,11,12a-tetrahydroxy-3,12-dioxo-7-[4-(trifluoromethyl)pyridin-1-ium-1-yl]-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide.
| Compound Name | (4S,4aS,5aR,12aR)-4-(dimethylamino)-1,10,11,12a-tetrahydroxy-3,12-dioxo-7-[4-(trifluoromethyl)pyridin-1-ium-1-yl]-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 90944018 |
| Molecular Formula | C27H25F3N3O7+ |
| Molecular Weight | 560.51 g/mol |
| Exact Mass | 560.16 |
| IUPAC Name | (4S,4aS,5aR,12aR)-4-(dimethylamino)-1,10,11,12a-tetrahydroxy-3,12-dioxo-7-[4-(trifluoromethyl)pyridin-1-ium-1-yl]-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
| SMILES | CN(C)[C@@H]1C(=O)C(C(N)=O)=C(O)[C@@]2(O)C(=O)C3=C(O)c4c(O)ccc(-[n+]5ccc(C(F)(F)F)cc5)c4C[C@H]3C[C@@H]12 |
| InChI | InChI=1S/C27H24F3N3O7/c1-32(2)20-14-10-11-9-13-15(33-7-5-12(6-8-33)27(28,29)30)3-4-16(34)18(13)21(35)17(11)23(37)26(14,40)24(38)19(22(20)36)25(31)39/h3-8,11,14,20,40H,9-10H2,1-2H3,(H4-,31,34,35,36,37,38,39)/p+1/t11-,14-,20-,26-/m0/s1 |
| InChIKey | OVBTVFBGMNRHRU-INJPKEBHSA-O |
| XLogP | 1.26 |
| TPSA | 165.27 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.51 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|