C10H21N3 — CID 90944521
(Z)-N'-(3-aminobutan-2-yl)-2-ethylbut-2-enimidamide (PubChem CID 90944521) has the molecular formula C10H21N3 and a molecular weight of 183.30 g/mol. Its IUPAC name is (Z)-N'-(3-aminobutan-2-yl)-2-ethylbut-2-enimidamide.
| Compound Name | (Z)-N'-(3-aminobutan-2-yl)-2-ethylbut-2-enimidamide |
|---|---|
| PubChem CID | 90944521 |
| Molecular Formula | C10H21N3 |
| Molecular Weight | 183.30 g/mol |
| Exact Mass | 183.17 |
| IUPAC Name | (Z)-N'-(3-aminobutan-2-yl)-2-ethylbut-2-enimidamide |
| SMILES | C/C=C(CC)\C(N)=N\C(C)C(C)N |
| InChI | InChI=1S/C10H21N3/c1-5-9(6-2)10(12)13-8(4)7(3)11/h5,7-8H,6,11H2,1-4H3,(H2,12,13)/b9-5- |
| InChIKey | IGWKNOFMEWGOMI-UITAMQMPSA-N |
| XLogP | 1.44 |
| TPSA | 64.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.30 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|