C7H13N3 — CID 177180063
5-(1-aminoethyl)-2,3-dihydropyridin-6-amine (PubChem CID 177180063) has the molecular formula C7H13N3 and a molecular weight of 139.20 g/mol. Its IUPAC name is 5-(1-aminoethyl)-2,3-dihydropyridin-6-amine.
| Compound Name | 5-(1-aminoethyl)-2,3-dihydropyridin-6-amine |
|---|---|
| PubChem CID | 177180063 |
| Molecular Formula | C7H13N3 |
| Molecular Weight | 139.20 g/mol |
| Exact Mass | 139.11 |
| IUPAC Name | 5-(1-aminoethyl)-2,3-dihydropyridin-6-amine |
| SMILES | CC(N)C1=CCCN=C1N |
| InChI | InChI=1S/C7H13N3/c1-5(8)6-3-2-4-10-7(6)9/h3,5H,2,4,8H2,1H3,(H2,9,10) |
| InChIKey | MJJVKUWJCJQCOK-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 64.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 139.20 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |