C7H13N3 — CID 166075907
N'-methyl-1,2,3,6-tetrahydropyridine-4-carboximidamide (PubChem CID 166075907) has the molecular formula C7H13N3 and a molecular weight of 139.20 g/mol. Its IUPAC name is N'-methyl-1,2,3,6-tetrahydropyridine-4-carboximidamide.
| Compound Name | N'-methyl-1,2,3,6-tetrahydropyridine-4-carboximidamide |
|---|---|
| PubChem CID | 166075907 |
| Molecular Formula | C7H13N3 |
| Molecular Weight | 139.20 g/mol |
| Exact Mass | 139.11 |
| IUPAC Name | N'-methyl-1,2,3,6-tetrahydropyridine-4-carboximidamide |
| SMILES | C/N=C(\N)C1=CCNCC1 |
| InChI | InChI=1S/C7H13N3/c1-9-7(8)6-2-4-10-5-3-6/h2,10H,3-5H2,1H3,(H2,8,9) |
| InChIKey | ZOYQQNNWIYWNIN-UHFFFAOYSA-N |
| XLogP | -0.11 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 139.20 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|