About (6-amino-4-methyl-2,3-dihydropyridin-5-yl)methylazanium
(6-amino-4-methyl-2,3-dihydropyridin-5-yl)methylazanium (PubChem CID 163808363) has the molecular formula C7H14N3+
and a molecular weight of 140.21 g/mol. Its IUPAC name is (6-amino-4-methyl-2,3-dihydropyridin-5-yl)methylazanium.
Molecular Properties
| Compound Name | (6-amino-4-methyl-2,3-dihydropyridin-5-yl)methylazanium |
| PubChem CID | 163808363 |
| Molecular Formula | C7H14N3+ |
| Molecular Weight | 140.21 g/mol |
| Exact Mass | 140.12 |
| IUPAC Name | (6-amino-4-methyl-2,3-dihydropyridin-5-yl)methylazanium |
| SMILES | CC1=C(C[NH3+])C(N)=NCC1 |
| InChI | InChI=1S/C7H13N3/c1-5-2-3-10-7(9)6(5)4-8/h2-4,8H2,1H3,(H2,9,10)/p+1 |
| InChIKey | NLBMJSHBSGIXBS-UHFFFAOYSA-O |
| XLogP | -0.69 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 140.21 |
| LogP ≤ 5 | -0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (6-amino-4-methyl-2,3-dihydropyridin-5-yl)methylazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6-amino-4-methyl-2,3-dihydropyridin-5-yl)methylazanium?
The IUPAC name of (6-amino-4-methyl-2,3-dihydropyridin-5-yl)methylazanium (CID 163808363) is (6-amino-4-methyl-2,3-dihydropyridin-5-yl)methylazanium.
What is the SMILES notation for (6-amino-4-methyl-2,3-dihydropyridin-5-yl)methylazanium?
The canonical SMILES for (6-amino-4-methyl-2,3-dihydropyridin-5-yl)methylazanium is CC1=C(C[NH3+])C(N)=NCC1.
What is the InChIKey of (6-amino-4-methyl-2,3-dihydropyridin-5-yl)methylazanium?
The InChIKey is NLBMJSHBSGIXBS-UHFFFAOYSA-O. The full InChI is InChI=1S/C7H13N3/c1-5-2-3-10-7(9)6(5)4-8/h2-4,8H2,1H3,(H2,9,10)/p+1.
What are the key properties of (6-amino-4-methyl-2,3-dihydropyridin-5-yl)methylazanium?
(6-amino-4-methyl-2,3-dihydropyridin-5-yl)methylazanium has a molecular weight of 140.21 g/mol, XLogP of -0.69, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (6-amino-4-methyl-2,3-dihydropyridin-5-yl)methylazanium is sourced from PubChem (CID 163808363), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).