About 5-(aminomethyl)-4-methyl-2,3-dihydropyridin-6-amine
5-(aminomethyl)-4-methyl-2,3-dihydropyridin-6-amine (PubChem CID 163808364) has the molecular formula C7H13N3
and a molecular weight of 139.20 g/mol. Its IUPAC name is 5-(aminomethyl)-4-methyl-2,3-dihydropyridin-6-amine.
Molecular Properties
| Compound Name | 5-(aminomethyl)-4-methyl-2,3-dihydropyridin-6-amine |
| PubChem CID | 163808364 |
| Molecular Formula | C7H13N3 |
| Molecular Weight | 139.20 g/mol |
| Exact Mass | 139.11 |
| IUPAC Name | 5-(aminomethyl)-4-methyl-2,3-dihydropyridin-6-amine |
| SMILES | CC1=C(CN)C(N)=NCC1 |
| InChI | InChI=1S/C7H13N3/c1-5-2-3-10-7(9)6(5)4-8/h2-4,8H2,1H3,(H2,9,10) |
| InChIKey | NLBMJSHBSGIXBS-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 64.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 139.20 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-(aminomethyl)-4-methyl-2,3-dihydropyridin-6-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(aminomethyl)-4-methyl-2,3-dihydropyridin-6-amine?
The IUPAC name of 5-(aminomethyl)-4-methyl-2,3-dihydropyridin-6-amine (CID 163808364) is 5-(aminomethyl)-4-methyl-2,3-dihydropyridin-6-amine.
What is the SMILES notation for 5-(aminomethyl)-4-methyl-2,3-dihydropyridin-6-amine?
The canonical SMILES for 5-(aminomethyl)-4-methyl-2,3-dihydropyridin-6-amine is CC1=C(CN)C(N)=NCC1.
What is the InChIKey of 5-(aminomethyl)-4-methyl-2,3-dihydropyridin-6-amine?
The InChIKey is NLBMJSHBSGIXBS-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13N3/c1-5-2-3-10-7(9)6(5)4-8/h2-4,8H2,1H3,(H2,9,10).
What are the key properties of 5-(aminomethyl)-4-methyl-2,3-dihydropyridin-6-amine?
5-(aminomethyl)-4-methyl-2,3-dihydropyridin-6-amine has a molecular weight of 139.20 g/mol, XLogP of 0.02, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(aminomethyl)-4-methyl-2,3-dihydropyridin-6-amine is sourced from PubChem (CID 163808364), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).