C22H26NO5Si+ — CID 90944710
(3,5-diphenyl-2,8,9-trioxa-5-azonia-1-silabicyclo[3.3.3]undecan-1-yl)methyl prop-2-enoate (PubChem CID 90944710) has the molecular formula C22H26NO5Si+ and a molecular weight of 412.54 g/mol. Its IUPAC name is (3,5-diphenyl-2,8,9-trioxa-5-azonia-1-silabicyclo[3.3.3]undecan-1-yl)methyl prop-2-enoate.
| Compound Name | (3,5-diphenyl-2,8,9-trioxa-5-azonia-1-silabicyclo[3.3.3]undecan-1-yl)methyl prop-2-enoate |
|---|---|
| PubChem CID | 90944710 |
| Molecular Formula | C22H26NO5Si+ |
| Molecular Weight | 412.54 g/mol |
| Exact Mass | 412.16 |
| IUPAC Name | (3,5-diphenyl-2,8,9-trioxa-5-azonia-1-silabicyclo[3.3.3]undecan-1-yl)methyl prop-2-enoate |
| SMILES | C=CC(=O)OC[Si]12OCC[N+](c3ccccc3)(CCO1)CC(c1ccccc1)O2 |
| InChI | InChI=1S/C22H26NO5Si/c1-2-22(24)25-18-29-26-15-13-23(14-16-27-29,20-11-7-4-8-12-20)17-21(28-29)19-9-5-3-6-10-19/h2-12,21H,1,13-18H2/q+1 |
| InChIKey | IVQCJJDOTGDUOM-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.54 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|