C10H12N2O2 — CID 90945721
2-(1-hydroxypropan-2-yl)-1H-indazol-3-one (PubChem CID 90945721) has the molecular formula C10H12N2O2 and a molecular weight of 192.22 g/mol. Its IUPAC name is 2-(1-hydroxypropan-2-yl)-1H-indazol-3-one.
| Compound Name | 2-(1-hydroxypropan-2-yl)-1H-indazol-3-one |
|---|---|
| PubChem CID | 90945721 |
| Molecular Formula | C10H12N2O2 |
| Molecular Weight | 192.22 g/mol |
| Exact Mass | 192.09 |
| IUPAC Name | 2-(1-hydroxypropan-2-yl)-1H-indazol-3-one |
| SMILES | CC(CO)n1[nH]c2ccccc2c1=O |
| InChI | InChI=1S/C10H12N2O2/c1-7(6-13)12-10(14)8-4-2-3-5-9(8)11-12/h2-5,7,11,13H,6H2,1H3 |
| InChIKey | NPXJUJOKVNXSEX-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 58.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.22 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het_65_B(7)', 'substructure': 'N/A'} |
|---|