C27H34ClN3O5 — CID 90945813
2-[[1-[7-chloro-3-[(3-methoxyphenyl)methyl]-4-oxopyrano[2,3-b]pyridin-2-yl]-2-methylpropyl]amino]ethyl N-(2-methylpropyl)carbamate (PubChem CID 90945813) has the molecular formula C27H34ClN3O5 and a molecular weight of 516.04 g/mol. Its IUPAC name is 2-[[1-[7-chloro-3-[(3-methoxyphenyl)methyl]-4-oxopyrano[2,3-b]pyridin-2-yl]-2-methylpropyl]amino]ethyl N-(2-methylpropyl)carbamate.
| Compound Name | 2-[[1-[7-chloro-3-[(3-methoxyphenyl)methyl]-4-oxopyrano[2,3-b]pyridin-2-yl]-2-methylpropyl]amino]ethyl N-(2-methylpropyl)carbamate |
|---|---|
| PubChem CID | 90945813 |
| Molecular Formula | C27H34ClN3O5 |
| Molecular Weight | 516.04 g/mol |
| Exact Mass | 515.22 |
| IUPAC Name | 2-[[1-[7-chloro-3-[(3-methoxyphenyl)methyl]-4-oxopyrano[2,3-b]pyridin-2-yl]-2-methylpropyl]amino]ethyl N-(2-methylpropyl)carbamate |
| SMILES | COc1cccc(Cc2c(C(NCCOC(=O)NCC(C)C)C(C)C)oc3nc(Cl)ccc3c2=O)c1 |
| InChI | InChI=1S/C27H34ClN3O5/c1-16(2)15-30-27(33)35-12-11-29-23(17(3)4)25-21(14-18-7-6-8-19(13-18)34-5)24(32)20-9-10-22(28)31-26(20)36-25/h6-10,13,16-17,23,29H,11-12,14-15H2,1-5H3,(H,30,33) |
| InChIKey | PFUFJCARSMYOND-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 102.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.04 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|