About dihexyl 2-methylpentan-3-yl phosphate
dihexyl 2-methylpentan-3-yl phosphate (PubChem CID 90947850) has the molecular formula C18H39O4P
and a molecular weight of 350.48 g/mol. Its IUPAC name is dihexyl 2-methylpentan-3-yl phosphate.
Molecular Properties
| Compound Name | dihexyl 2-methylpentan-3-yl phosphate |
| PubChem CID | 90947850 |
| Molecular Formula | C18H39O4P |
| Molecular Weight | 350.48 g/mol |
| Exact Mass | 350.26 |
| IUPAC Name | dihexyl 2-methylpentan-3-yl phosphate |
| SMILES | CCCCCCOP(=O)(OCCCCCC)OC(CC)C(C)C |
| InChI | InChI=1S/C18H39O4P/c1-6-9-11-13-15-20-23(19,21-16-14-12-10-7-2)22-18(8-3)17(4)5/h17-18H,6-16H2,1-5H3 |
| InChIKey | QQVYCUUJUXQHFD-UHFFFAOYSA-N |
| XLogP | 6.74 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 350.48 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze dihexyl 2-methylpentan-3-yl phosphate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dihexyl 2-methylpentan-3-yl phosphate?
The IUPAC name of dihexyl 2-methylpentan-3-yl phosphate (CID 90947850) is dihexyl 2-methylpentan-3-yl phosphate.
What is the SMILES notation for dihexyl 2-methylpentan-3-yl phosphate?
The canonical SMILES for dihexyl 2-methylpentan-3-yl phosphate is CCCCCCOP(=O)(OCCCCCC)OC(CC)C(C)C.
What is the InChIKey of dihexyl 2-methylpentan-3-yl phosphate?
The InChIKey is QQVYCUUJUXQHFD-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H39O4P/c1-6-9-11-13-15-20-23(19,21-16-14-12-10-7-2)22-18(8-3)17(4)5/h17-18H,6-16H2,1-5H3.
What are the key properties of dihexyl 2-methylpentan-3-yl phosphate?
dihexyl 2-methylpentan-3-yl phosphate has a molecular weight of 350.48 g/mol, XLogP of 6.74, 16 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for dihexyl 2-methylpentan-3-yl phosphate is sourced from PubChem (CID 90947850), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).