C47H40O2 — CID 90948278
[1-(4-tert-butylbenzoyl)-9,9'-spirobi[fluorene]-2-yl]-(4-tert-butylphenyl)methanone (PubChem CID 90948278) has the molecular formula C47H40O2 and a molecular weight of 636.84 g/mol. Its IUPAC name is [1-(4-tert-butylbenzoyl)-9,9'-spirobi[fluorene]-2-yl]-(4-tert-butylphenyl)methanone.
| Compound Name | [1-(4-tert-butylbenzoyl)-9,9'-spirobi[fluorene]-2-yl]-(4-tert-butylphenyl)methanone |
|---|---|
| PubChem CID | 90948278 |
| Molecular Formula | C47H40O2 |
| Molecular Weight | 636.84 g/mol |
| Exact Mass | 636.30 |
| IUPAC Name | [1-(4-tert-butylbenzoyl)-9,9'-spirobi[fluorene]-2-yl]-(4-tert-butylphenyl)methanone |
| SMILES | CC(C)(C)c1ccc(C(=O)c2ccc3c(c2C(=O)c2ccc(C(C)(C)C)cc2)C2(c4ccccc4-c4ccccc42)c2ccccc2-3)cc1 |
| InChI | InChI=1S/C47H40O2/c1-45(2,3)31-23-19-29(20-24-31)43(48)37-28-27-36-35-15-9-12-18-40(35)47(38-16-10-7-13-33(38)34-14-8-11-17-39(34)47)42(36)41(37)44(49)30-21-25-32(26-22-30)46(4,5)6/h7-28H,1-6H3 |
| InChIKey | INEBQGXUGKGUFC-UHFFFAOYSA-N |
| XLogP | 11.09 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.84 |
| LogP ≤ 5 | 11.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |