C15H23NO2 — CID 90948671
ethyl 2-(C,N-dimethylcarbonimidoyl)-3-methyl-4-methylideneocta-5,7-dienoate (PubChem CID 90948671) has the molecular formula C15H23NO2 and a molecular weight of 249.35 g/mol. Its IUPAC name is ethyl 2-(C,N-dimethylcarbonimidoyl)-3-methyl-4-methylideneocta-5,7-dienoate.
| Compound Name | ethyl 2-(C,N-dimethylcarbonimidoyl)-3-methyl-4-methylideneocta-5,7-dienoate |
|---|---|
| PubChem CID | 90948671 |
| Molecular Formula | C15H23NO2 |
| Molecular Weight | 249.35 g/mol |
| Exact Mass | 249.17 |
| IUPAC Name | ethyl 2-(C,N-dimethylcarbonimidoyl)-3-methyl-4-methylideneocta-5,7-dienoate |
| SMILES | C=CC=CC(=C)C(C)C(C(=O)OCC)/C(C)=N/C |
| InChI | InChI=1S/C15H23NO2/c1-7-9-10-11(3)12(4)14(13(5)16-6)15(17)18-8-2/h7,9-10,12,14H,1,3,8H2,2,4-6H3/b10-9?,16-13+ |
| InChIKey | BLXHIBRSYWKXAV-LZZQPPRSSA-N |
| XLogP | 3.19 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.35 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|