C25H26N2O4S2 — CID 90949374
5-[[4-[(4aR,8aS)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]phenyl]methylidene]-3-[(5-hydroxy-4-oxopyran-2-yl)methyl]-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 90949374) has the molecular formula C25H26N2O4S2 and a molecular weight of 482.63 g/mol. Its IUPAC name is 5-[[4-[(4aR,8aS)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]phenyl]methylidene]-3-[(5-hydroxy-4-oxopyran-2-yl)methyl]-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | 5-[[4-[(4aR,8aS)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]phenyl]methylidene]-3-[(5-hydroxy-4-oxopyran-2-yl)methyl]-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 90949374 |
| Molecular Formula | C25H26N2O4S2 |
| Molecular Weight | 482.63 g/mol |
| Exact Mass | 482.13 |
| IUPAC Name | 5-[[4-[(4aR,8aS)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]phenyl]methylidene]-3-[(5-hydroxy-4-oxopyran-2-yl)methyl]-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | O=C1C(=Cc2ccc(N3CC[C@H]4CCCC[C@@H]4C3)cc2)SC(=S)N1Cc1cc(=O)c(O)co1 |
| InChI | InChI=1S/C25H26N2O4S2/c28-21-12-20(31-15-22(21)29)14-27-24(30)23(33-25(27)32)11-16-5-7-19(8-6-16)26-10-9-17-3-1-2-4-18(17)13-26/h5-8,11-12,15,17-18,29H,1-4,9-10,13-14H2/t17-,18-/m1/s1 |
| InChIKey | XCHBYQLHKQCEBS-QZTJIDSGSA-N |
| XLogP | 4.76 |
| TPSA | 73.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.63 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|