C11H21NO — CID 90949402
6-amino-3,7-dimethylnon-7-en-4-one (PubChem CID 90949402) has the molecular formula C11H21NO and a molecular weight of 183.29 g/mol. Its IUPAC name is 6-amino-3,7-dimethylnon-7-en-4-one.
| Compound Name | 6-amino-3,7-dimethylnon-7-en-4-one |
|---|---|
| PubChem CID | 90949402 |
| Molecular Formula | C11H21NO |
| Molecular Weight | 183.29 g/mol |
| Exact Mass | 183.16 |
| IUPAC Name | 6-amino-3,7-dimethylnon-7-en-4-one |
| SMILES | CC=C(C)C(N)CC(=O)C(C)CC |
| InChI | InChI=1S/C11H21NO/c1-5-8(3)10(12)7-11(13)9(4)6-2/h5,9-10H,6-7,12H2,1-4H3 |
| InChIKey | IXCSHPTYCFPYRS-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.29 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|