C33H31N7O2S — CID 90950378
N-[4-[4-amino-7-[3-(pyridin-2-ylmethylamino)prop-1-enyl]thieno[3,2-c]pyridin-3-yl]-2-methoxyphenyl]-1-methylindole-2-carbohydrazide (PubChem CID 90950378) has the molecular formula C33H31N7O2S and a molecular weight of 589.73 g/mol. Its IUPAC name is N-[4-[4-amino-7-[3-(pyridin-2-ylmethylamino)prop-1-enyl]thieno[3,2-c]pyridin-3-yl]-2-methoxyphenyl]-1-methylindole-2-carbohydrazide.
| Compound Name | N-[4-[4-amino-7-[3-(pyridin-2-ylmethylamino)prop-1-enyl]thieno[3,2-c]pyridin-3-yl]-2-methoxyphenyl]-1-methylindole-2-carbohydrazide |
|---|---|
| PubChem CID | 90950378 |
| Molecular Formula | C33H31N7O2S |
| Molecular Weight | 589.73 g/mol |
| Exact Mass | 589.23 |
| IUPAC Name | N-[4-[4-amino-7-[3-(pyridin-2-ylmethylamino)prop-1-enyl]thieno[3,2-c]pyridin-3-yl]-2-methoxyphenyl]-1-methylindole-2-carbohydrazide |
| SMILES | COc1cc(-c2csc3c(C=CCNCc4ccccn4)cnc(N)c23)ccc1N(N)C(=O)c1cc2ccccc2n1C |
| InChI | InChI=1S/C33H31N7O2S/c1-39-26-11-4-3-8-22(26)16-28(39)33(41)40(35)27-13-12-21(17-29(27)42-2)25-20-43-31-23(18-38-32(34)30(25)31)9-7-14-36-19-24-10-5-6-15-37-24/h3-13,15-18,20,36H,14,19,35H2,1-2H3,(H2,34,38) |
| InChIKey | ZOPMPMGBCDAWLW-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 124.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.73 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|