C20H17NO5 — CID 90952398
3-(2,4-dimethylphenyl)-2-(6-methyl-2-oxo-1,4-benzoxazin-3-yl)-3-oxopropanoic acid (PubChem CID 90952398) has the molecular formula C20H17NO5 and a molecular weight of 351.36 g/mol. Its IUPAC name is 3-(2,4-dimethylphenyl)-2-(6-methyl-2-oxo-1,4-benzoxazin-3-yl)-3-oxopropanoic acid.
| Compound Name | 3-(2,4-dimethylphenyl)-2-(6-methyl-2-oxo-1,4-benzoxazin-3-yl)-3-oxopropanoic acid |
|---|---|
| PubChem CID | 90952398 |
| Molecular Formula | C20H17NO5 |
| Molecular Weight | 351.36 g/mol |
| Exact Mass | 351.11 |
| IUPAC Name | 3-(2,4-dimethylphenyl)-2-(6-methyl-2-oxo-1,4-benzoxazin-3-yl)-3-oxopropanoic acid |
| SMILES | Cc1ccc(C(=O)C(C(=O)O)c2nc3cc(C)ccc3oc2=O)c(C)c1 |
| InChI | InChI=1S/C20H17NO5/c1-10-4-6-13(12(3)8-10)18(22)16(19(23)24)17-20(25)26-15-7-5-11(2)9-14(15)21-17/h4-9,16H,1-3H3,(H,23,24) |
| InChIKey | VBXLJNZATZKVFA-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 97.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.36 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|