C26H29FN4O8 — CID 90953557
(2R)-N-[(5aR,6aS,7S,10aS)-9-carbamoyl-7-(dimethylamino)-4-fluoro-1,10a-dihydroxy-8,10,11,12-tetraoxo-5,5a,6,6a,7,11a-hexahydrotetracen-2-yl]pyrrolidine-2-carboxamide (PubChem CID 90953557) has the molecular formula C26H29FN4O8 and a molecular weight of 544.54 g/mol. Its IUPAC name is (2R)-N-[(5aR,6aS,7S,10aS)-9-carbamoyl-7-(dimethylamino)-4-fluoro-1,10a-dihydroxy-8,10,11,12-tetraoxo-5,5a,6,6a,7,11a-hexahydrotetracen-2-yl]pyrrolidine-2-carboxamide.
| Compound Name | (2R)-N-[(5aR,6aS,7S,10aS)-9-carbamoyl-7-(dimethylamino)-4-fluoro-1,10a-dihydroxy-8,10,11,12-tetraoxo-5,5a,6,6a,7,11a-hexahydrotetracen-2-yl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 90953557 |
| Molecular Formula | C26H29FN4O8 |
| Molecular Weight | 544.54 g/mol |
| Exact Mass | 544.20 |
| IUPAC Name | (2R)-N-[(5aR,6aS,7S,10aS)-9-carbamoyl-7-(dimethylamino)-4-fluoro-1,10a-dihydroxy-8,10,11,12-tetraoxo-5,5a,6,6a,7,11a-hexahydrotetracen-2-yl]pyrrolidine-2-carboxamide |
| SMILES | CN(C)[C@@H]1C(=O)C(C(N)=O)C(=O)[C@@]2(O)C(=O)C3C(=O)c4c(O)c(NC(=O)[C@H]5CCCN5)cc(F)c4C[C@H]3C[C@@H]12 |
| InChI | InChI=1S/C26H29FN4O8/c1-31(2)18-11-7-9-6-10-12(27)8-14(30-25(38)13-4-3-5-29-13)19(32)16(10)20(33)15(9)22(35)26(11,39)23(36)17(21(18)34)24(28)37/h8-9,11,13,15,17-18,29,32,39H,3-7H2,1-2H3,(H2,28,37)(H,30,38)/t9-,11-,13+,15?,17?,18-,26-/m0/s1 |
| InChIKey | RLLSJBJXEIXSSD-OLEICSMNSA-N |
| XLogP | -1.30 |
| TPSA | 196.20 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.54 |
| LogP ≤ 5 | -1.30 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|