C23H34N8O2 — CID 90953758
N'-[(2,6-dipyrrolidin-1-ylpyrimidin-4-yl)methyl]-N-[2-(4-nitroanilino)ethyl]ethane-1,2-diamine (PubChem CID 90953758) has the molecular formula C23H34N8O2 and a molecular weight of 454.58 g/mol. Its IUPAC name is N'-[(2,6-dipyrrolidin-1-ylpyrimidin-4-yl)methyl]-N-[2-(4-nitroanilino)ethyl]ethane-1,2-diamine.
| Compound Name | N'-[(2,6-dipyrrolidin-1-ylpyrimidin-4-yl)methyl]-N-[2-(4-nitroanilino)ethyl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 90953758 |
| Molecular Formula | C23H34N8O2 |
| Molecular Weight | 454.58 g/mol |
| Exact Mass | 454.28 |
| IUPAC Name | N'-[(2,6-dipyrrolidin-1-ylpyrimidin-4-yl)methyl]-N-[2-(4-nitroanilino)ethyl]ethane-1,2-diamine |
| SMILES | O=[N+]([O-])c1ccc(NCCNCCNCc2cc(N3CCCC3)nc(N3CCCC3)n2)cc1 |
| InChI | InChI=1S/C23H34N8O2/c32-31(33)21-7-5-19(6-8-21)26-12-11-24-9-10-25-18-20-17-22(29-13-1-2-14-29)28-23(27-20)30-15-3-4-16-30/h5-8,17,24-26H,1-4,9-16,18H2 |
| InChIKey | XXBDSBONPVFXJB-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 111.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.58 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|