About 4-ethyl-1,1-dimethyl-4-propylpiperidin-1-ium
4-ethyl-1,1-dimethyl-4-propylpiperidin-1-ium (PubChem CID 90954061) has the molecular formula C12H26N+
and a molecular weight of 184.35 g/mol. Its IUPAC name is 4-ethyl-1,1-dimethyl-4-propylpiperidin-1-ium.
Molecular Properties
| Compound Name | 4-ethyl-1,1-dimethyl-4-propylpiperidin-1-ium |
| PubChem CID | 90954061 |
| Molecular Formula | C12H26N+ |
| Molecular Weight | 184.35 g/mol |
| Exact Mass | 184.21 |
| IUPAC Name | 4-ethyl-1,1-dimethyl-4-propylpiperidin-1-ium |
| SMILES | CCCC1(CC)CC[N+](C)(C)CC1 |
| InChI | InChI=1S/C12H26N/c1-5-7-12(6-2)8-10-13(3,4)11-9-12/h5-11H2,1-4H3/q+1 |
| InChIKey | LALXTBXLIFTHOL-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.35 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze 4-ethyl-1,1-dimethyl-4-propylpiperidin-1-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethyl-1,1-dimethyl-4-propylpiperidin-1-ium?
The IUPAC name of 4-ethyl-1,1-dimethyl-4-propylpiperidin-1-ium (CID 90954061) is 4-ethyl-1,1-dimethyl-4-propylpiperidin-1-ium.
What is the SMILES notation for 4-ethyl-1,1-dimethyl-4-propylpiperidin-1-ium?
The canonical SMILES for 4-ethyl-1,1-dimethyl-4-propylpiperidin-1-ium is CCCC1(CC)CC[N+](C)(C)CC1.
What is the InChIKey of 4-ethyl-1,1-dimethyl-4-propylpiperidin-1-ium?
The InChIKey is LALXTBXLIFTHOL-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H26N/c1-5-7-12(6-2)8-10-13(3,4)11-9-12/h5-11H2,1-4H3/q+1.
What are the key properties of 4-ethyl-1,1-dimethyl-4-propylpiperidin-1-ium?
4-ethyl-1,1-dimethyl-4-propylpiperidin-1-ium has a molecular weight of 184.35 g/mol, XLogP of 3.05, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethyl-1,1-dimethyl-4-propylpiperidin-1-ium is sourced from PubChem (CID 90954061), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).