C25H26N4O8 — CID 90954453
(4aR,5S,5aR,6R,12aS)-9-[(5-ethyl-1H-imidazol-2-yl)amino]-5,10,12a-trihydroxy-6-methyl-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide (PubChem CID 90954453) has the molecular formula C25H26N4O8 and a molecular weight of 510.50 g/mol. Its IUPAC name is (4aR,5S,5aR,6R,12aS)-9-[(5-ethyl-1H-imidazol-2-yl)amino]-5,10,12a-trihydroxy-6-methyl-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide.
| Compound Name | (4aR,5S,5aR,6R,12aS)-9-[(5-ethyl-1H-imidazol-2-yl)amino]-5,10,12a-trihydroxy-6-methyl-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
|---|---|
| PubChem CID | 90954453 |
| Molecular Formula | C25H26N4O8 |
| Molecular Weight | 510.50 g/mol |
| Exact Mass | 510.18 |
| IUPAC Name | (4aR,5S,5aR,6R,12aS)-9-[(5-ethyl-1H-imidazol-2-yl)amino]-5,10,12a-trihydroxy-6-methyl-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
| SMILES | CCc1cnc(Nc2ccc3c(c2O)C(=O)C2C(=O)[C@]4(O)C(=O)C(C(N)=O)C(=O)C[C@@H]4[C@@H](O)[C@@H]2[C@H]3C)[nH]1 |
| InChI | InChI=1S/C25H26N4O8/c1-3-9-7-27-24(28-9)29-12-5-4-10-8(2)14-17(20(33)15(10)19(12)32)22(35)25(37)11(18(14)31)6-13(30)16(21(25)34)23(26)36/h4-5,7-8,11,14,16-18,31-32,37H,3,6H2,1-2H3,(H2,26,36)(H2,27,28,29)/t8-,11+,14+,16?,17?,18+,25+/m0/s1 |
| InChIKey | FSFNSMKJOSUXRT-RTUOUUCQSA-N |
| XLogP | -0.11 |
| TPSA | 212.77 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.50 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|