C33H29FN2O3 — CID 90954911
7-[2-cyclopropyl-4-(4-fluorophenyl)quinolin-3-yl]-3,5-dioxo-N-(2-phenylethyl)hept-6-enamide (PubChem CID 90954911) has the molecular formula C33H29FN2O3 and a molecular weight of 520.60 g/mol. Its IUPAC name is 7-[2-cyclopropyl-4-(4-fluorophenyl)quinolin-3-yl]-3,5-dioxo-N-(2-phenylethyl)hept-6-enamide.
| Compound Name | 7-[2-cyclopropyl-4-(4-fluorophenyl)quinolin-3-yl]-3,5-dioxo-N-(2-phenylethyl)hept-6-enamide |
|---|---|
| PubChem CID | 90954911 |
| Molecular Formula | C33H29FN2O3 |
| Molecular Weight | 520.60 g/mol |
| Exact Mass | 520.22 |
| IUPAC Name | 7-[2-cyclopropyl-4-(4-fluorophenyl)quinolin-3-yl]-3,5-dioxo-N-(2-phenylethyl)hept-6-enamide |
| SMILES | O=C(C=Cc1c(C2CC2)nc2ccccc2c1-c1ccc(F)cc1)CC(=O)CC(=O)NCCc1ccccc1 |
| InChI | InChI=1S/C33H29FN2O3/c34-25-14-12-23(13-15-25)32-28-8-4-5-9-30(28)36-33(24-10-11-24)29(32)17-16-26(37)20-27(38)21-31(39)35-19-18-22-6-2-1-3-7-22/h1-9,12-17,24H,10-11,18-21H2,(H,35,39) |
| InChIKey | XKGYIPNWALXTCQ-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 76.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.60 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|