C27H25ClFN3O5 — CID 90957512
methyl 2-[4-[[1-[chloro(phenyl)carbamoyl]-4-methoxypyrrolidine-2-carbonyl]amino]phenyl]-6-fluorobenzoate (PubChem CID 90957512) has the molecular formula C27H25ClFN3O5 and a molecular weight of 525.96 g/mol. Its IUPAC name is methyl 2-[4-[[1-[chloro(phenyl)carbamoyl]-4-methoxypyrrolidine-2-carbonyl]amino]phenyl]-6-fluorobenzoate.
| Compound Name | methyl 2-[4-[[1-[chloro(phenyl)carbamoyl]-4-methoxypyrrolidine-2-carbonyl]amino]phenyl]-6-fluorobenzoate |
|---|---|
| PubChem CID | 90957512 |
| Molecular Formula | C27H25ClFN3O5 |
| Molecular Weight | 525.96 g/mol |
| Exact Mass | 525.15 |
| IUPAC Name | methyl 2-[4-[[1-[chloro(phenyl)carbamoyl]-4-methoxypyrrolidine-2-carbonyl]amino]phenyl]-6-fluorobenzoate |
| SMILES | COC(=O)c1c(F)cccc1-c1ccc(NC(=O)C2CC(OC)CN2C(=O)N(Cl)c2ccccc2)cc1 |
| InChI | InChI=1S/C27H25ClFN3O5/c1-36-20-15-23(31(16-20)27(35)32(28)19-7-4-3-5-8-19)25(33)30-18-13-11-17(12-14-18)21-9-6-10-22(29)24(21)26(34)37-2/h3-14,20,23H,15-16H2,1-2H3,(H,30,33) |
| InChIKey | MYMUVLKULANIKP-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 88.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.96 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|