C24H27ClN4O5 — CID 91481913
1-[4-[[1-[chloro(phenyl)carbamoyl]-4-methoxypyrrolidine-2-carbonyl]amino]phenyl]pyrrolidine-2-carboxylic acid (PubChem CID 91481913) has the molecular formula C24H27ClN4O5 and a molecular weight of 486.96 g/mol. Its IUPAC name is 1-[4-[[1-[chloro(phenyl)carbamoyl]-4-methoxypyrrolidine-2-carbonyl]amino]phenyl]pyrrolidine-2-carboxylic acid.
| Compound Name | 1-[4-[[1-[chloro(phenyl)carbamoyl]-4-methoxypyrrolidine-2-carbonyl]amino]phenyl]pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 91481913 |
| Molecular Formula | C24H27ClN4O5 |
| Molecular Weight | 486.96 g/mol |
| Exact Mass | 486.17 |
| IUPAC Name | 1-[4-[[1-[chloro(phenyl)carbamoyl]-4-methoxypyrrolidine-2-carbonyl]amino]phenyl]pyrrolidine-2-carboxylic acid |
| SMILES | COC1CC(C(=O)Nc2ccc(N3CCCC3C(=O)O)cc2)N(C(=O)N(Cl)c2ccccc2)C1 |
| InChI | InChI=1S/C24H27ClN4O5/c1-34-19-14-21(28(15-19)24(33)29(25)18-6-3-2-4-7-18)22(30)26-16-9-11-17(12-10-16)27-13-5-8-20(27)23(31)32/h2-4,6-7,9-12,19-21H,5,8,13-15H2,1H3,(H,26,30)(H,31,32) |
| InChIKey | YAXCQFJTTOMYOA-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 102.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.96 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|