C6H10N2O2 — CID 90961945
1-methyl-3-(methylamino)pyrrole-2,5-diol (PubChem CID 90961945) has the molecular formula C6H10N2O2 and a molecular weight of 142.16 g/mol. Its IUPAC name is 1-methyl-3-(methylamino)pyrrole-2,5-diol.
| Compound Name | 1-methyl-3-(methylamino)pyrrole-2,5-diol |
|---|---|
| PubChem CID | 90961945 |
| Molecular Formula | C6H10N2O2 |
| Molecular Weight | 142.16 g/mol |
| Exact Mass | 142.07 |
| IUPAC Name | 1-methyl-3-(methylamino)pyrrole-2,5-diol |
| SMILES | CNc1cc(O)n(C)c1O |
| InChI | InChI=1S/C6H10N2O2/c1-7-4-3-5(9)8(2)6(4)10/h3,7,9-10H,1-2H3 |
| InChIKey | IJVFIXFCPANQON-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 57.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 142.16 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |