C7H16N2 — CID 90964331
1-(2,3-dimethylbut-3-enyl)-2-methylhydrazine (PubChem CID 90964331) has the molecular formula C7H16N2 and a molecular weight of 128.22 g/mol. Its IUPAC name is 1-(2,3-dimethylbut-3-enyl)-2-methylhydrazine.
| Compound Name | 1-(2,3-dimethylbut-3-enyl)-2-methylhydrazine |
|---|---|
| PubChem CID | 90964331 |
| Molecular Formula | C7H16N2 |
| Molecular Weight | 128.22 g/mol |
| Exact Mass | 128.13 |
| IUPAC Name | 1-(2,3-dimethylbut-3-enyl)-2-methylhydrazine |
| SMILES | C=C(C)C(C)CNNC |
| InChI | InChI=1S/C7H16N2/c1-6(2)7(3)5-9-8-4/h7-9H,1,5H2,2-4H3 |
| InChIKey | APYBUPCYJNDGEO-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 128.22 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|