C14H16F3NO2 — CID 90964693
ethyl 4,4,4-trifluoro-3-[(1S)-1-phenylethyl]iminobutanoate (PubChem CID 90964693) has the molecular formula C14H16F3NO2 and a molecular weight of 287.28 g/mol. Its IUPAC name is ethyl 4,4,4-trifluoro-3-[(1S)-1-phenylethyl]iminobutanoate.
| Compound Name | ethyl 4,4,4-trifluoro-3-[(1S)-1-phenylethyl]iminobutanoate |
|---|---|
| PubChem CID | 90964693 |
| Molecular Formula | C14H16F3NO2 |
| Molecular Weight | 287.28 g/mol |
| Exact Mass | 287.11 |
| IUPAC Name | ethyl 4,4,4-trifluoro-3-[(1S)-1-phenylethyl]iminobutanoate |
| SMILES | CCOC(=O)C/C(=N\[C@@H](C)c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C14H16F3NO2/c1-3-20-13(19)9-12(14(15,16)17)18-10(2)11-7-5-4-6-8-11/h4-8,10H,3,9H2,1-2H3/b18-12+/t10-/m0/s1 |
| InChIKey | YNMAERRRWAWTPK-QCQOHNBASA-N |
| XLogP | 3.70 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.28 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|