C13H25FO — CID 90964698
7-(fluoromethoxy)-3,4-dimethyldec-5-ene (PubChem CID 90964698) has the molecular formula C13H25FO and a molecular weight of 216.34 g/mol. Its IUPAC name is 7-(fluoromethoxy)-3,4-dimethyldec-5-ene.
| Compound Name | 7-(fluoromethoxy)-3,4-dimethyldec-5-ene |
|---|---|
| PubChem CID | 90964698 |
| Molecular Formula | C13H25FO |
| Molecular Weight | 216.34 g/mol |
| Exact Mass | 216.19 |
| IUPAC Name | 7-(fluoromethoxy)-3,4-dimethyldec-5-ene |
| SMILES | CCCC(C=CC(C)C(C)CC)OCF |
| InChI | InChI=1S/C13H25FO/c1-5-7-13(15-10-14)9-8-12(4)11(3)6-2/h8-9,11-13H,5-7,10H2,1-4H3 |
| InChIKey | JBYDLPNBPNUHRC-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.34 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|