C15H13ClN2O5 — CID 90965237
2-chloro-4,6-dihydroxy-N-[2-(3-hydroxyphenyl)acetyl]benzohydrazide (PubChem CID 90965237) has the molecular formula C15H13ClN2O5 and a molecular weight of 336.73 g/mol. Its IUPAC name is 2-chloro-4,6-dihydroxy-N-[2-(3-hydroxyphenyl)acetyl]benzohydrazide.
| Compound Name | 2-chloro-4,6-dihydroxy-N-[2-(3-hydroxyphenyl)acetyl]benzohydrazide |
|---|---|
| PubChem CID | 90965237 |
| Molecular Formula | C15H13ClN2O5 |
| Molecular Weight | 336.73 g/mol |
| Exact Mass | 336.05 |
| IUPAC Name | 2-chloro-4,6-dihydroxy-N-[2-(3-hydroxyphenyl)acetyl]benzohydrazide |
| SMILES | NN(C(=O)Cc1cccc(O)c1)C(=O)c1c(O)cc(O)cc1Cl |
| InChI | InChI=1S/C15H13ClN2O5/c16-11-6-10(20)7-12(21)14(11)15(23)18(17)13(22)5-8-2-1-3-9(19)4-8/h1-4,6-7,19-21H,5,17H2 |
| InChIKey | FMYKFVSDWVKSRA-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 124.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.73 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|