C15H13ClN2O6 — CID 90755127
2-chloro-4,6-dihydroxy-N-[2-hydroxy-2-(3-hydroxyphenyl)acetyl]benzohydrazide (PubChem CID 90755127) has the molecular formula C15H13ClN2O6 and a molecular weight of 352.73 g/mol. Its IUPAC name is 2-chloro-4,6-dihydroxy-N-[2-hydroxy-2-(3-hydroxyphenyl)acetyl]benzohydrazide.
| Compound Name | 2-chloro-4,6-dihydroxy-N-[2-hydroxy-2-(3-hydroxyphenyl)acetyl]benzohydrazide |
|---|---|
| PubChem CID | 90755127 |
| Molecular Formula | C15H13ClN2O6 |
| Molecular Weight | 352.73 g/mol |
| Exact Mass | 352.05 |
| IUPAC Name | 2-chloro-4,6-dihydroxy-N-[2-hydroxy-2-(3-hydroxyphenyl)acetyl]benzohydrazide |
| SMILES | NN(C(=O)c1c(O)cc(O)cc1Cl)C(=O)C(O)c1cccc(O)c1 |
| InChI | InChI=1S/C15H13ClN2O6/c16-10-5-9(20)6-11(21)12(10)14(23)18(17)15(24)13(22)7-2-1-3-8(19)4-7/h1-6,13,19-22H,17H2 |
| InChIKey | MGYFHGBKDRUOAI-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 144.32 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.73 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|